Code Never Lies, Comments Sometimes Do.....: Code Decode

Python Basic Programs

1. Python program to add two numbers

# Python3 program to add two numbers

num1 = 15
num2 = 12

# Adding two nos
sum = num1 + num2

# printing values
print("Sum of {0} and {1} is {2}" .format(num1, num2, sum))

2.Python Program for factorial of a number

# Python 3 program to find

# factorial of given number

def factorial(n):

# single line to find factorial

return 1 if (n==1 or n==0) else n * factorial(n - 1);

# Driver Code

num = 5;

print("Factorial of",num,"is",

factorial(num))

3. Python Program for simple interest

# Python3 program to find simple interest
# for given principal amount, time and
# rate of interest.

# We can change values here for
# different inputs
P = 1
R = 1
T = 1

# Calculates simple interest
SI = (P * R * T) / 100

# Print the resultant value of SI
print("simple interest is", SI)

4. Python Program for compound interest

# Python3 program to find compound
# interest for given values.

def compound_interest(principle, rate, time):

   # Calculates compound interest
   CI = principle * (pow((1 + rate / 100), time))
   print("Compound interest is", CI)

# Driver Code
compound_interest(10000, 10.25, 5)

5. Python Program for Program to find area of a circle

# Python program to find Area of a circle
def findArea(r):
PI = 3.142
return PI * (r*r);

# Driver method
print("Area is %.6f" % findArea(5));

6. Python program to print all Prime numbers in an Interval

# Python program to print all
# prime number in an interval
start = 11
end = 25

for val in range(start, end + 1):

# If num is divisible by any number
# between 2 and val, it is not prime
if val > 1:
    for n in range(2, val):
        if (val % n) == 0:
            break
    else:
        print(val)

7. Python program to check whether a number is Prime or not

# Python program to check if
# given number is prime or not
num = 11

# If given number is greater than 1
if num > 1:

# Iterate from 2 to n / 2
for i in range(2, num//2):

    # If num is divisible by any number between
    # 2 and n / 2, it is not prime
    if (num % i) == 0:
        print(num, "is not a prime number")
        break
else:
    print(num, "is a prime number")

else:
print(num, "is not a prime number")

8. Python Program for n-th Fibonacci number

# Function for nth Fibonacci number
def Fibonacci(n):
   if n<0:
       print("Incorrect input")
   # First Fibonacci number is 0
   elif n==1:
       return 0
   # Second Fibonacci number is 1
   elif n==2:
       return 1
   else:
       return Fibonacci(n-1)+Fibonacci(n-2)

# Driver Program
print(Fibonacci(9))

9. Python Program for Fibonacci numbers

# Function for nth Fibonacci number
def Fibonacci(n):
    if n<0:
        print("Incorrect input")
    # First Fibonacci number is 0
    elif n==1:
        return 0
    # Second Fibonacci number is 1
    elif n==2:
        return 1
    else:
        return Fibonacci(n-1)+Fibonacci(n-2)

# Driver Program

print(Fibonacci(9))

10. Python Program to check Armstrong Number

# Python program to determine whether the number is

# Armstrong number or not

# Function to calculate x raised to the power y

def power(x, y):

if y==0:

return 1

if y%2==0:

return power(x, y/2)*power(x, y/2)

return x*power(x, y/2)*power(x, y/2)

# Function to calculate order of the number

def order(x):

# variable to store of the number

n = 0

while (x!=0):

n = n+1

x = x/10

return n

# Function to check whether the given number is

# Armstrong number or not

def isArmstrong (x):

n = order(x)

temp = x

sum1 = 0

while (temp!=0):

r = temp%10

sum1 = sum1 + power(r, n)

temp = temp/10

# If condition satisfies

return (sum1 == x)

# Driver Program

x = 153

print(isArmstrong(x))

x = 1253

print(isArmstrong(x)

Python List Programs

1. Python Program to find sum of elements of list

# Python 3 code to find sum

# of elements in given array

def _sum(arr,n):

# return sum using sum

# inbuilt sum() function

return(sum(arr))

# driver function

arr = []

# input values to list

arr = [12, 3, 4, 15]

# calculating length of array

n = len(arr)

ans = _sum(arr,n)

# display sum

print (\'Sum of the array is \',ans)

2. Python Program to find largest element in an array

# Python3 program to find maximum

# in arr[] of size n

# python function to find maximum

# in arr[] of size n

def largest(arr,n):

# Initialize maximum element

max = arr[0]

# Traverse array elements from second

# and compare every element with

# current max

for i in range(1, n):

if arr[i] > max:

max = arr[i]

return max